About CID 175825723
CID 175825723 (PubChem CID 175825723) has the molecular formula C6H4F3NNaO
and a molecular weight of 186.09 g/mol.
Molecular Properties
| Compound Name | CID 175825723 |
| PubChem CID | 175825723 |
| Molecular Formula | C6H4F3NNaO |
| Molecular Weight | 186.09 g/mol |
| Exact Mass | 186.01 |
| IUPAC Name | — |
| SMILES | O=c1cccc(C(F)(F)F)[nH]1.[Na] |
| InChI | InChI=1S/C6H4F3NO.Na/c7-6(8,9)4-2-1-3-5(11)10-4;/h1-3H,(H,10,11); |
| InChIKey | ZNDIAJJPFNJCBC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.09 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 175825723 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175825723?
The IUPAC name of CID 175825723 (CID 175825723) is not available.
What is the SMILES notation for CID 175825723?
The canonical SMILES for CID 175825723 is O=c1cccc(C(F)(F)F)[nH]1.[Na].
What is the InChIKey of CID 175825723?
The InChIKey is ZNDIAJJPFNJCBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F3NO.Na/c7-6(8,9)4-2-1-3-5(11)10-4;/h1-3H,(H,10,11);.
What are the key properties of CID 175825723?
CID 175825723 has a molecular weight of 186.09 g/mol, XLogP of 1.01, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175825723 is sourced from PubChem (CID 175825723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).