C18H13F4N3O — CID 175826085
2-[3-fluoro-4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenyl]benzamide (PubChem CID 175826085) has the molecular formula C18H13F4N3O and a molecular weight of 363.31 g/mol. Its IUPAC name is 2-[3-fluoro-4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenyl]benzamide.
| Compound Name | 2-[3-fluoro-4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 175826085 |
| Molecular Formula | C18H13F4N3O |
| Molecular Weight | 363.31 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 2-[3-fluoro-4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenyl]benzamide |
| SMILES | Cn1nc(C(F)(F)F)cc1-c1ccc(-c2ccccc2C(N)=O)cc1F |
| InChI | InChI=1S/C18H13F4N3O/c1-25-15(9-16(24-25)18(20,21)22)13-7-6-10(8-14(13)19)11-4-2-3-5-12(11)17(23)26/h2-9H,1H3,(H2,23,26) |
| InChIKey | VHOAMIHESQETPR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.31 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |