C17H15F3N2O3 — CID 175826255
6-[2,6-difluoro-4-(oxan-3-yloxy)phenyl]-5-fluoropyridine-2-carboxamide (PubChem CID 175826255) has the molecular formula C17H15F3N2O3 and a molecular weight of 352.31 g/mol. Its IUPAC name is 6-[2,6-difluoro-4-(oxan-3-yloxy)phenyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | 6-[2,6-difluoro-4-(oxan-3-yloxy)phenyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 175826255 |
| Molecular Formula | C17H15F3N2O3 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 6-[2,6-difluoro-4-(oxan-3-yloxy)phenyl]-5-fluoropyridine-2-carboxamide |
| SMILES | NC(=O)c1ccc(F)c(-c2c(F)cc(OC3CCCOC3)cc2F)n1 |
| InChI | InChI=1S/C17H15F3N2O3/c18-11-3-4-14(17(21)23)22-16(11)15-12(19)6-10(7-13(15)20)25-9-2-1-5-24-8-9/h3-4,6-7,9H,1-2,5,8H2,(H2,21,23) |
| InChIKey | UKSDJCWWBSXDRA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |