C31H33ClF4N6O5 — CID 175826695
5-[7-[3-chloro-5-(methoxymethoxy)-2-(trifluoromethyl)phenyl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-2,5-diazabicyclo[2.2.2]octane-2-carboxylic acid (PubChem CID 175826695) has the molecular formula C31H33ClF4N6O5 and a molecular weight of 681.09 g/mol. Its IUPAC name is 5-[7-[3-chloro-5-(methoxymethoxy)-2-(trifluoromethyl)phenyl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-2,5-diazabicyclo[2.2.2]octane-2-carboxylic acid.
| Compound Name | 5-[7-[3-chloro-5-(methoxymethoxy)-2-(trifluoromethyl)phenyl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-2,5-diazabicyclo[2.2.2]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 175826695 |
| Molecular Formula | C31H33ClF4N6O5 |
| Molecular Weight | 681.09 g/mol |
| Exact Mass | 680.21 |
| IUPAC Name | 5-[7-[3-chloro-5-(methoxymethoxy)-2-(trifluoromethyl)phenyl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-2,5-diazabicyclo[2.2.2]octane-2-carboxylic acid |
| SMILES | COCOc1cc(Cl)c(C(F)(F)F)c(-c2ncc3c(N4CC5CCC4CN5C(=O)O)nc(OCC45CCCN4CCC5)nc3c2F)c1 |
| InChI | InChI=1S/C31H33ClF4N6O5/c1-45-16-47-19-10-20(23(22(32)11-19)31(34,35)36)25-24(33)26-21(12-37-25)27(41-13-18-5-4-17(41)14-42(18)29(43)44)39-28(38-26)46-15-30-6-2-8-40(30)9-3-7-30/h10-12,17-18H,2-9,13-16H2,1H3,(H,43,44) |
| InChIKey | XVKMZVRZZCGGPK-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 113.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.09 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|