C13H11FN4O2 — CID 175826750
5-(2-cyano-3-fluoro-4-methoxyphenyl)-1-methylimidazole-2-carboxamide (PubChem CID 175826750) has the molecular formula C13H11FN4O2 and a molecular weight of 274.26 g/mol. Its IUPAC name is 5-(2-cyano-3-fluoro-4-methoxyphenyl)-1-methylimidazole-2-carboxamide.
| Compound Name | 5-(2-cyano-3-fluoro-4-methoxyphenyl)-1-methylimidazole-2-carboxamide |
|---|---|
| PubChem CID | 175826750 |
| Molecular Formula | C13H11FN4O2 |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 5-(2-cyano-3-fluoro-4-methoxyphenyl)-1-methylimidazole-2-carboxamide |
| SMILES | COc1ccc(-c2cnc(C(N)=O)n2C)c(C#N)c1F |
| InChI | InChI=1S/C13H11FN4O2/c1-18-9(6-17-13(18)12(16)19)7-3-4-10(20-2)11(14)8(7)5-15/h3-4,6H,1-2H3,(H2,16,19) |
| InChIKey | ITEFMMAWICIALV-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 93.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |