About 2-[4-(4-fluorophenyl)-2-methyl-1,3-oxazol-5-yl]-N,N-dipropylbenzenesulfonamide
2-[4-(4-fluorophenyl)-2-methyl-1,3-oxazol-5-yl]-N,N-dipropylbenzenesulfonamide (PubChem CID 175827402) has the molecular formula C22H25FN2O3S
and a molecular weight of 416.52 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)-2-methyl-1,3-oxazol-5-yl]-N,N-dipropylbenzenesulfonamide.
Molecular Properties
| Compound Name | 2-[4-(4-fluorophenyl)-2-methyl-1,3-oxazol-5-yl]-N,N-dipropylbenzenesulfonamide |
| PubChem CID | 175827402 |
| Molecular Formula | C22H25FN2O3S |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 2-[4-(4-fluorophenyl)-2-methyl-1,3-oxazol-5-yl]-N,N-dipropylbenzenesulfonamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccccc1-c1oc(C)nc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H25FN2O3S/c1-4-14-25(15-5-2)29(26,27)20-9-7-6-8-19(20)22-21(24-16(3)28-22)17-10-12-18(23)13-11-17/h6-13H,4-5,14-15H2,1-3H3 |
| InChIKey | PJSSYICZQYDUOH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(4-fluorophenyl)-2-methyl-1,3-oxazol-5-yl]-N,N-dipropylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-fluorophenyl)-2-methyl-1,3-oxazol-5-yl]-N,N-dipropylbenzenesulfonamide?
The IUPAC name of 2-[4-(4-fluorophenyl)-2-methyl-1,3-oxazol-5-yl]-N,N-dipropylbenzenesulfonamide (CID 175827402) is 2-[4-(4-fluorophenyl)-2-methyl-1,3-oxazol-5-yl]-N,N-dipropylbenzenesulfonamide.
What is the SMILES notation for 2-[4-(4-fluorophenyl)-2-methyl-1,3-oxazol-5-yl]-N,N-dipropylbenzenesulfonamide?
The canonical SMILES for 2-[4-(4-fluorophenyl)-2-methyl-1,3-oxazol-5-yl]-N,N-dipropylbenzenesulfonamide is CCCN(CCC)S(=O)(=O)c1ccccc1-c1oc(C)nc1-c1ccc(F)cc1.
What is the InChIKey of 2-[4-(4-fluorophenyl)-2-methyl-1,3-oxazol-5-yl]-N,N-dipropylbenzenesulfonamide?
The InChIKey is PJSSYICZQYDUOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25FN2O3S/c1-4-14-25(15-5-2)29(26,27)20-9-7-6-8-19(20)22-21(24-16(3)28-22)17-10-12-18(23)13-11-17/h6-13H,4-5,14-15H2,1-3H3.
What are the key properties of 2-[4-(4-fluorophenyl)-2-methyl-1,3-oxazol-5-yl]-N,N-dipropylbenzenesulfonamide?
2-[4-(4-fluorophenyl)-2-methyl-1,3-oxazol-5-yl]-N,N-dipropylbenzenesulfonamide has a molecular weight of 416.52 g/mol, XLogP of 5.27, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-fluorophenyl)-2-methyl-1,3-oxazol-5-yl]-N,N-dipropylbenzenesulfonamide is sourced from PubChem (CID 175827402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).