About methyl 4H-pyrido[3,4-b]indole-3-carboxylate
methyl 4H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 175828193) has the molecular formula C13H10N2O2
and a molecular weight of 226.24 g/mol. Its IUPAC name is methyl 4H-pyrido[3,4-b]indole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 4H-pyrido[3,4-b]indole-3-carboxylate |
| PubChem CID | 175828193 |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | methyl 4H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)C1=NC=C2N=c3ccccc3=C2C1 |
| InChI | InChI=1S/C13H10N2O2/c1-17-13(16)11-6-9-8-4-2-3-5-10(8)15-12(9)7-14-11/h2-5,7H,6H2,1H3 |
| InChIKey | XZMWBJOEIFKTME-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4H-pyrido[3,4-b]indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4H-pyrido[3,4-b]indole-3-carboxylate?
The IUPAC name of methyl 4H-pyrido[3,4-b]indole-3-carboxylate (CID 175828193) is methyl 4H-pyrido[3,4-b]indole-3-carboxylate.
What is the SMILES notation for methyl 4H-pyrido[3,4-b]indole-3-carboxylate?
The canonical SMILES for methyl 4H-pyrido[3,4-b]indole-3-carboxylate is COC(=O)C1=NC=C2N=c3ccccc3=C2C1.
What is the InChIKey of methyl 4H-pyrido[3,4-b]indole-3-carboxylate?
The InChIKey is XZMWBJOEIFKTME-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O2/c1-17-13(16)11-6-9-8-4-2-3-5-10(8)15-12(9)7-14-11/h2-5,7H,6H2,1H3.
What are the key properties of methyl 4H-pyrido[3,4-b]indole-3-carboxylate?
methyl 4H-pyrido[3,4-b]indole-3-carboxylate has a molecular weight of 226.24 g/mol, XLogP of 0.33, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4H-pyrido[3,4-b]indole-3-carboxylate is sourced from PubChem (CID 175828193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).