About 1-[(3,3-difluorocyclobutyl)methyl]-3-ethyl-4-(trifluoromethyl)pyrazole
1-[(3,3-difluorocyclobutyl)methyl]-3-ethyl-4-(trifluoromethyl)pyrazole (PubChem CID 175828622) has the molecular formula C11H13F5N2
and a molecular weight of 268.23 g/mol. Its IUPAC name is 1-[(3,3-difluorocyclobutyl)methyl]-3-ethyl-4-(trifluoromethyl)pyrazole.
Molecular Properties
| Compound Name | 1-[(3,3-difluorocyclobutyl)methyl]-3-ethyl-4-(trifluoromethyl)pyrazole |
| PubChem CID | 175828622 |
| Molecular Formula | C11H13F5N2 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 1-[(3,3-difluorocyclobutyl)methyl]-3-ethyl-4-(trifluoromethyl)pyrazole |
| SMILES | CCc1nn(CC2CC(F)(F)C2)cc1C(F)(F)F |
| InChI | InChI=1S/C11H13F5N2/c1-2-9-8(11(14,15)16)6-18(17-9)5-7-3-10(12,13)4-7/h6-7H,2-5H2,1H3 |
| InChIKey | MBGJXDSPZFUVSQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(3,3-difluorocyclobutyl)methyl]-3-ethyl-4-(trifluoromethyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,3-difluorocyclobutyl)methyl]-3-ethyl-4-(trifluoromethyl)pyrazole?
The IUPAC name of 1-[(3,3-difluorocyclobutyl)methyl]-3-ethyl-4-(trifluoromethyl)pyrazole (CID 175828622) is 1-[(3,3-difluorocyclobutyl)methyl]-3-ethyl-4-(trifluoromethyl)pyrazole.
What is the SMILES notation for 1-[(3,3-difluorocyclobutyl)methyl]-3-ethyl-4-(trifluoromethyl)pyrazole?
The canonical SMILES for 1-[(3,3-difluorocyclobutyl)methyl]-3-ethyl-4-(trifluoromethyl)pyrazole is CCc1nn(CC2CC(F)(F)C2)cc1C(F)(F)F.
What is the InChIKey of 1-[(3,3-difluorocyclobutyl)methyl]-3-ethyl-4-(trifluoromethyl)pyrazole?
The InChIKey is MBGJXDSPZFUVSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F5N2/c1-2-9-8(11(14,15)16)6-18(17-9)5-7-3-10(12,13)4-7/h6-7H,2-5H2,1H3.
What are the key properties of 1-[(3,3-difluorocyclobutyl)methyl]-3-ethyl-4-(trifluoromethyl)pyrazole?
1-[(3,3-difluorocyclobutyl)methyl]-3-ethyl-4-(trifluoromethyl)pyrazole has a molecular weight of 268.23 g/mol, XLogP of 3.51, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,3-difluorocyclobutyl)methyl]-3-ethyl-4-(trifluoromethyl)pyrazole is sourced from PubChem (CID 175828622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).