About 3-cyclopropyl-1-[(4,4-difluorocyclohexyl)methyl]-4-(trifluoromethyl)pyrazole
3-cyclopropyl-1-[(4,4-difluorocyclohexyl)methyl]-4-(trifluoromethyl)pyrazole (PubChem CID 175828677) has the molecular formula C14H17F5N2
and a molecular weight of 308.29 g/mol. Its IUPAC name is 3-cyclopropyl-1-[(4,4-difluorocyclohexyl)methyl]-4-(trifluoromethyl)pyrazole.
Molecular Properties
| Compound Name | 3-cyclopropyl-1-[(4,4-difluorocyclohexyl)methyl]-4-(trifluoromethyl)pyrazole |
| PubChem CID | 175828677 |
| Molecular Formula | C14H17F5N2 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 3-cyclopropyl-1-[(4,4-difluorocyclohexyl)methyl]-4-(trifluoromethyl)pyrazole |
| SMILES | FC1(F)CCC(Cn2cc(C(F)(F)F)c(C3CC3)n2)CC1 |
| InChI | InChI=1S/C14H17F5N2/c15-13(16)5-3-9(4-6-13)7-21-8-11(14(17,18)19)12(20-21)10-1-2-10/h8-10H,1-7H2 |
| InChIKey | FGTGUXBKMOBWLN-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclopropyl-1-[(4,4-difluorocyclohexyl)methyl]-4-(trifluoromethyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-1-[(4,4-difluorocyclohexyl)methyl]-4-(trifluoromethyl)pyrazole?
The IUPAC name of 3-cyclopropyl-1-[(4,4-difluorocyclohexyl)methyl]-4-(trifluoromethyl)pyrazole (CID 175828677) is 3-cyclopropyl-1-[(4,4-difluorocyclohexyl)methyl]-4-(trifluoromethyl)pyrazole.
What is the SMILES notation for 3-cyclopropyl-1-[(4,4-difluorocyclohexyl)methyl]-4-(trifluoromethyl)pyrazole?
The canonical SMILES for 3-cyclopropyl-1-[(4,4-difluorocyclohexyl)methyl]-4-(trifluoromethyl)pyrazole is FC1(F)CCC(Cn2cc(C(F)(F)F)c(C3CC3)n2)CC1.
What is the InChIKey of 3-cyclopropyl-1-[(4,4-difluorocyclohexyl)methyl]-4-(trifluoromethyl)pyrazole?
The InChIKey is FGTGUXBKMOBWLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F5N2/c15-13(16)5-3-9(4-6-13)7-21-8-11(14(17,18)19)12(20-21)10-1-2-10/h8-10H,1-7H2.
What are the key properties of 3-cyclopropyl-1-[(4,4-difluorocyclohexyl)methyl]-4-(trifluoromethyl)pyrazole?
3-cyclopropyl-1-[(4,4-difluorocyclohexyl)methyl]-4-(trifluoromethyl)pyrazole has a molecular weight of 308.29 g/mol, XLogP of 4.60, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-1-[(4,4-difluorocyclohexyl)methyl]-4-(trifluoromethyl)pyrazole is sourced from PubChem (CID 175828677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).