About 3-[4-methyl-5-(methylamino)-3-pyridinyl]-2,7-naphthyridin-1-amine
3-[4-methyl-5-(methylamino)-3-pyridinyl]-2,7-naphthyridin-1-amine (PubChem CID 175828772) has the molecular formula C15H15N5
and a molecular weight of 265.32 g/mol. Its IUPAC name is 3-[4-methyl-5-(methylamino)-3-pyridinyl]-2,7-naphthyridin-1-amine.
Molecular Properties
| Compound Name | 3-[4-methyl-5-(methylamino)-3-pyridinyl]-2,7-naphthyridin-1-amine |
| PubChem CID | 175828772 |
| Molecular Formula | C15H15N5 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 3-[4-methyl-5-(methylamino)-3-pyridinyl]-2,7-naphthyridin-1-amine |
| SMILES | CNc1cncc(-c2cc3ccncc3c(N)n2)c1C |
| InChI | InChI=1S/C15H15N5/c1-9-11(6-19-8-14(9)17-2)13-5-10-3-4-18-7-12(10)15(16)20-13/h3-8,17H,1-2H3,(H2,16,20) |
| InChIKey | YDRGKAWCKKCRNF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[4-methyl-5-(methylamino)-3-pyridinyl]-2,7-naphthyridin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-methyl-5-(methylamino)-3-pyridinyl]-2,7-naphthyridin-1-amine?
The IUPAC name of 3-[4-methyl-5-(methylamino)-3-pyridinyl]-2,7-naphthyridin-1-amine (CID 175828772) is 3-[4-methyl-5-(methylamino)-3-pyridinyl]-2,7-naphthyridin-1-amine.
What is the SMILES notation for 3-[4-methyl-5-(methylamino)-3-pyridinyl]-2,7-naphthyridin-1-amine?
The canonical SMILES for 3-[4-methyl-5-(methylamino)-3-pyridinyl]-2,7-naphthyridin-1-amine is CNc1cncc(-c2cc3ccncc3c(N)n2)c1C.
What is the InChIKey of 3-[4-methyl-5-(methylamino)-3-pyridinyl]-2,7-naphthyridin-1-amine?
The InChIKey is YDRGKAWCKKCRNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N5/c1-9-11(6-19-8-14(9)17-2)13-5-10-3-4-18-7-12(10)15(16)20-13/h3-8,17H,1-2H3,(H2,16,20).
What are the key properties of 3-[4-methyl-5-(methylamino)-3-pyridinyl]-2,7-naphthyridin-1-amine?
3-[4-methyl-5-(methylamino)-3-pyridinyl]-2,7-naphthyridin-1-amine has a molecular weight of 265.32 g/mol, XLogP of 2.62, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-methyl-5-(methylamino)-3-pyridinyl]-2,7-naphthyridin-1-amine is sourced from PubChem (CID 175828772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).