C20H38O7 — CID 175829501
[3-(3-hydroxy-2,2-dimethylpropanoyl)oxy-2,2-dimethylpropyl] 3,6-dihydroxy-2,2,5,5-tetramethylhexanoate (PubChem CID 175829501) has the molecular formula C20H38O7 and a molecular weight of 390.52 g/mol. Its IUPAC name is [3-(3-hydroxy-2,2-dimethylpropanoyl)oxy-2,2-dimethylpropyl] 3,6-dihydroxy-2,2,5,5-tetramethylhexanoate.
| Compound Name | [3-(3-hydroxy-2,2-dimethylpropanoyl)oxy-2,2-dimethylpropyl] 3,6-dihydroxy-2,2,5,5-tetramethylhexanoate |
|---|---|
| PubChem CID | 175829501 |
| Molecular Formula | C20H38O7 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | [3-(3-hydroxy-2,2-dimethylpropanoyl)oxy-2,2-dimethylpropyl] 3,6-dihydroxy-2,2,5,5-tetramethylhexanoate |
| SMILES | CC(C)(COC(=O)C(C)(C)CO)COC(=O)C(C)(C)C(O)CC(C)(C)CO |
| InChI | InChI=1S/C20H38O7/c1-17(2,10-21)9-14(23)20(7,8)16(25)27-13-18(3,4)12-26-15(24)19(5,6)11-22/h14,21-23H,9-13H2,1-8H3 |
| InChIKey | ZCWIWNMFRGBDJQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |