C34H32Cl2CoN2Si2 — CID 175829725
dichlorocobalt;[3-[dimethyl(phenyl)silyl]-5-(1,10-phenanthrolin-2-yl)phenyl]-dimethyl-phenylsilane (PubChem CID 175829725) has the molecular formula C34H32Cl2CoN2Si2 and a molecular weight of 654.66 g/mol. Its IUPAC name is dichlorocobalt;[3-[dimethyl(phenyl)silyl]-5-(1,10-phenanthrolin-2-yl)phenyl]-dimethyl-phenylsilane.
| Compound Name | dichlorocobalt;[3-[dimethyl(phenyl)silyl]-5-(1,10-phenanthrolin-2-yl)phenyl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 175829725 |
| Molecular Formula | C34H32Cl2CoN2Si2 |
| Molecular Weight | 654.66 g/mol |
| Exact Mass | 653.08 |
| IUPAC Name | dichlorocobalt;[3-[dimethyl(phenyl)silyl]-5-(1,10-phenanthrolin-2-yl)phenyl]-dimethyl-phenylsilane |
| SMILES | C[Si](C)(c1ccccc1)c1cc(-c2ccc3ccc4cccnc4c3n2)cc([Si](C)(C)c2ccccc2)c1.Cl[Co]Cl |
| InChI | InChI=1S/C34H32N2Si2.2ClH.Co/c1-37(2,28-13-7-5-8-14-28)30-22-27(23-31(24-30)38(3,4)29-15-9-6-10-16-29)32-20-19-26-18-17-25-12-11-21-35-33(25)34(26)36-32;;;/h5-24H,1-4H3;2*1H;/q;;;+2/p-2 |
| InChIKey | PBNNUDKDAOKTOY-UHFFFAOYSA-L |
| XLogP | 7.47 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.66 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|