C25H27F3N2O3 — CID 175830500
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[3,3-dimethyl-7-(2,4,5-trifluorophenyl)-2,4-dihydrochromen-4-yl]carbamate (PubChem CID 175830500) has the molecular formula C25H27F3N2O3 and a molecular weight of 460.50 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[3,3-dimethyl-7-(2,4,5-trifluorophenyl)-2,4-dihydrochromen-4-yl]carbamate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[3,3-dimethyl-7-(2,4,5-trifluorophenyl)-2,4-dihydrochromen-4-yl]carbamate |
|---|---|
| PubChem CID | 175830500 |
| Molecular Formula | C25H27F3N2O3 |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[3,3-dimethyl-7-(2,4,5-trifluorophenyl)-2,4-dihydrochromen-4-yl]carbamate |
| SMILES | CC1(C)COc2cc(-c3cc(F)c(F)cc3F)ccc2C1NC(=O)O[C@H]1CN2CCC1CC2 |
| InChI | InChI=1S/C25H27F3N2O3/c1-25(2)13-32-21-9-15(17-10-19(27)20(28)11-18(17)26)3-4-16(21)23(25)29-24(31)33-22-12-30-7-5-14(22)6-8-30/h3-4,9-11,14,22-23H,5-8,12-13H2,1-2H3,(H,29,31)/t22-,23?/m0/s1 |
| InChIKey | PBXOIUASUSQSSS-NQCNTLBGSA-N |
| XLogP | 5.05 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|