C28H31ClF3N3O5S — CID 175830772
3-[3-(4,4-difluoropiperidin-1-yl)propoxy]-4-(4-fluorophenyl)-N-[4-hydroxy-3-(methanesulfonamido)phenyl]benzamide;hydrochloride (PubChem CID 175830772) has the molecular formula C28H31ClF3N3O5S and a molecular weight of 614.09 g/mol. Its IUPAC name is 3-[3-(4,4-difluoropiperidin-1-yl)propoxy]-4-(4-fluorophenyl)-N-[4-hydroxy-3-(methanesulfonamido)phenyl]benzamide;hydrochloride.
| Compound Name | 3-[3-(4,4-difluoropiperidin-1-yl)propoxy]-4-(4-fluorophenyl)-N-[4-hydroxy-3-(methanesulfonamido)phenyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 175830772 |
| Molecular Formula | C28H31ClF3N3O5S |
| Molecular Weight | 614.09 g/mol |
| Exact Mass | 613.16 |
| IUPAC Name | 3-[3-(4,4-difluoropiperidin-1-yl)propoxy]-4-(4-fluorophenyl)-N-[4-hydroxy-3-(methanesulfonamido)phenyl]benzamide;hydrochloride |
| SMILES | CS(=O)(=O)Nc1cc(NC(=O)c2ccc(-c3ccc(F)cc3)c(OCCCN3CCC(F)(F)CC3)c2)ccc1O.Cl |
| InChI | InChI=1S/C28H30F3N3O5S.ClH/c1-40(37,38)33-24-18-22(8-10-25(24)35)32-27(36)20-5-9-23(19-3-6-21(29)7-4-19)26(17-20)39-16-2-13-34-14-11-28(30,31)12-15-34;/h3-10,17-18,33,35H,2,11-16H2,1H3,(H,32,36);1H |
| InChIKey | WHXNHPOXJUOGQE-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.09 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|