About 2-pyrazin-2-ylpyrazolo[1,5-a]pyrimidine
2-pyrazin-2-ylpyrazolo[1,5-a]pyrimidine (PubChem CID 175830982) has the molecular formula C10H7N5
and a molecular weight of 197.20 g/mol. Its IUPAC name is 2-pyrazin-2-ylpyrazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | 2-pyrazin-2-ylpyrazolo[1,5-a]pyrimidine |
| PubChem CID | 175830982 |
| Molecular Formula | C10H7N5 |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 2-pyrazin-2-ylpyrazolo[1,5-a]pyrimidine |
| SMILES | c1cnc2cc(-c3cnccn3)nn2c1 |
| InChI | InChI=1S/C10H7N5/c1-2-13-10-6-8(14-15(10)5-1)9-7-11-3-4-12-9/h1-7H |
| InChIKey | ZGZYTEJZHRTVES-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-pyrazin-2-ylpyrazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrazin-2-ylpyrazolo[1,5-a]pyrimidine?
The IUPAC name of 2-pyrazin-2-ylpyrazolo[1,5-a]pyrimidine (CID 175830982) is 2-pyrazin-2-ylpyrazolo[1,5-a]pyrimidine.
What is the SMILES notation for 2-pyrazin-2-ylpyrazolo[1,5-a]pyrimidine?
The canonical SMILES for 2-pyrazin-2-ylpyrazolo[1,5-a]pyrimidine is c1cnc2cc(-c3cnccn3)nn2c1.
What is the InChIKey of 2-pyrazin-2-ylpyrazolo[1,5-a]pyrimidine?
The InChIKey is ZGZYTEJZHRTVES-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N5/c1-2-13-10-6-8(14-15(10)5-1)9-7-11-3-4-12-9/h1-7H.
What are the key properties of 2-pyrazin-2-ylpyrazolo[1,5-a]pyrimidine?
2-pyrazin-2-ylpyrazolo[1,5-a]pyrimidine has a molecular weight of 197.20 g/mol, XLogP of 1.19, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrazin-2-ylpyrazolo[1,5-a]pyrimidine is sourced from PubChem (CID 175830982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).