C19H26N2O — CID 175831076
3-[(3aR,5R,7aR)-1,3,3,5,7-pentamethyl-4,6,7,7a-tetrahydro-3aH-2,1-benzoxazol-5-yl]benzonitrile (PubChem CID 175831076) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is 3-[(3aR,5R,7aR)-1,3,3,5,7-pentamethyl-4,6,7,7a-tetrahydro-3aH-2,1-benzoxazol-5-yl]benzonitrile.
| Compound Name | 3-[(3aR,5R,7aR)-1,3,3,5,7-pentamethyl-4,6,7,7a-tetrahydro-3aH-2,1-benzoxazol-5-yl]benzonitrile |
|---|---|
| PubChem CID | 175831076 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 3-[(3aR,5R,7aR)-1,3,3,5,7-pentamethyl-4,6,7,7a-tetrahydro-3aH-2,1-benzoxazol-5-yl]benzonitrile |
| SMILES | CC1C[C@@](C)(c2cccc(C#N)c2)C[C@@H]2[C@@H]1N(C)OC2(C)C |
| InChI | InChI=1S/C19H26N2O/c1-13-10-19(4,15-8-6-7-14(9-15)12-20)11-16-17(13)21(5)22-18(16,2)3/h6-9,13,16-17H,10-11H2,1-5H3/t13?,16-,17-,19-/m1/s1 |
| InChIKey | YVRPPCBCKPMFMX-IKZGXORXSA-N |
| XLogP | 3.89 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |