C27H33FN4O3S — CID 175831227
3-[(3R,4S)-3-fluoropiperidin-4-yl]-2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-propylindol-4-amine (PubChem CID 175831227) has the molecular formula C27H33FN4O3S and a molecular weight of 512.65 g/mol. Its IUPAC name is 3-[(3R,4S)-3-fluoropiperidin-4-yl]-2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-propylindol-4-amine.
| Compound Name | 3-[(3R,4S)-3-fluoropiperidin-4-yl]-2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-propylindol-4-amine |
|---|---|
| PubChem CID | 175831227 |
| Molecular Formula | C27H33FN4O3S |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | 3-[(3R,4S)-3-fluoropiperidin-4-yl]-2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-propylindol-4-amine |
| SMILES | CCCn1c(C#CCNc2ccc(S(C)(=O)=O)cc2OC)c([C@@H]2CCNC[C@@H]2F)c2c(N)cccc21 |
| InChI | InChI=1S/C27H33FN4O3S/c1-4-15-32-23(9-6-13-31-22-11-10-18(36(3,33)34)16-25(22)35-2)26(19-12-14-30-17-20(19)28)27-21(29)7-5-8-24(27)32/h5,7-8,10-11,16,19-20,30-31H,4,12-15,17,29H2,1-3H3/t19-,20+/m1/s1 |
| InChIKey | WNKRJOVNAJHNKF-UXHICEINSA-N |
| XLogP | 3.92 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|