C23H29N9 — CID 175831639
3-N-[4-[4-(2-bicyclo[2.2.1]heptanyl)piperazin-1-yl]phenyl]-1-pyrimidin-4-yl-1,2,4-triazole-3,5-diamine (PubChem CID 175831639) has the molecular formula C23H29N9 and a molecular weight of 431.55 g/mol. Its IUPAC name is 3-N-[4-[4-(2-bicyclo[2.2.1]heptanyl)piperazin-1-yl]phenyl]-1-pyrimidin-4-yl-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-[4-[4-(2-bicyclo[2.2.1]heptanyl)piperazin-1-yl]phenyl]-1-pyrimidin-4-yl-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 175831639 |
| Molecular Formula | C23H29N9 |
| Molecular Weight | 431.55 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | 3-N-[4-[4-(2-bicyclo[2.2.1]heptanyl)piperazin-1-yl]phenyl]-1-pyrimidin-4-yl-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nc(Nc2ccc(N3CCN(C4CC5CCC4C5)CC3)cc2)nn1-c1ccncn1 |
| InChI | InChI=1S/C23H29N9/c24-22-28-23(29-32(22)21-7-8-25-15-26-21)27-18-3-5-19(6-4-18)30-9-11-31(12-10-30)20-14-16-1-2-17(20)13-16/h3-8,15-17,20H,1-2,9-14H2,(H3,24,27,28,29) |
| InChIKey | PMSKQXWWRXMNGN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 101.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.55 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|