C28H38F5N3O6 — CID 175832144
3-[8-[2-[(4,4-difluorocyclohexyl)methyl-[(2S)-2,3-dihydroxypropanoyl]amino]ethyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 175832144) has the molecular formula C28H38F5N3O6 and a molecular weight of 607.62 g/mol. Its IUPAC name is 3-[8-[2-[(4,4-difluorocyclohexyl)methyl-[(2S)-2,3-dihydroxypropanoyl]amino]ethyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[8-[2-[(4,4-difluorocyclohexyl)methyl-[(2S)-2,3-dihydroxypropanoyl]amino]ethyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175832144 |
| Molecular Formula | C28H38F5N3O6 |
| Molecular Weight | 607.62 g/mol |
| Exact Mass | 607.27 |
| IUPAC Name | 3-[8-[2-[(4,4-difluorocyclohexyl)methyl-[(2S)-2,3-dihydroxypropanoyl]amino]ethyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)c1cccc(C2CC3CCC(C2)N3CCN(CC2CCC(F)(F)CC2)C(=O)[C@@H](O)CO)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H37F2N3O4.C2HF3O2/c27-26(28)8-6-17(7-9-26)15-30(25(35)23(33)16-32)10-11-31-21-4-5-22(31)14-20(13-21)18-2-1-3-19(12-18)24(29)34;3-2(4,5)1(6)7/h1-3,12,17,20-23,32-33H,4-11,13-16H2,(H2,29,34);(H,6,7)/t20?,21?,22?,23-;/m0./s1 |
| InChIKey | QFKNULUFQAANIK-HWTMJUSISA-N |
| XLogP | 3.14 |
| TPSA | 144.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.62 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |