C12H15F2NO4 — CID 175832842
2-[(1R,2R,3S,6S,8R)-7,7-difluoro-2-(nitromethyl)-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid (PubChem CID 175832842) has the molecular formula C12H15F2NO4 and a molecular weight of 275.25 g/mol. Its IUPAC name is 2-[(1R,2R,3S,6S,8R)-7,7-difluoro-2-(nitromethyl)-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid.
| Compound Name | 2-[(1R,2R,3S,6S,8R)-7,7-difluoro-2-(nitromethyl)-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid |
|---|---|
| PubChem CID | 175832842 |
| Molecular Formula | C12H15F2NO4 |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 2-[(1R,2R,3S,6S,8R)-7,7-difluoro-2-(nitromethyl)-2-tricyclo[4.2.1.03,8]nonanyl]acetic acid |
| SMILES | O=C(O)C[C@]1(C[N+](=O)[O-])[C@@H]2C[C@@H]3CC[C@H]1[C@H]2C3(F)F |
| InChI | InChI=1S/C12H15F2NO4/c13-12(14)6-1-2-7-10(12)8(3-6)11(7,4-9(16)17)5-15(18)19/h6-8,10H,1-5H2,(H,16,17)/t6-,7-,8+,10+,11+/m0/s1 |
| InChIKey | XGQUXZZEXXPASY-WFADCGHZSA-N |
| XLogP | 2.04 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|