C14H14O4 — CID 175833179
5-[2-(4-hydroxyphenyl)ethenyl]cyclohexa-3,5-diene-1,1,3-triol (PubChem CID 175833179) has the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. Its IUPAC name is 5-[2-(4-hydroxyphenyl)ethenyl]cyclohexa-3,5-diene-1,1,3-triol.
| Compound Name | 5-[2-(4-hydroxyphenyl)ethenyl]cyclohexa-3,5-diene-1,1,3-triol |
|---|---|
| PubChem CID | 175833179 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 5-[2-(4-hydroxyphenyl)ethenyl]cyclohexa-3,5-diene-1,1,3-triol |
| SMILES | OC1=CC(C=Cc2ccc(O)cc2)=CC(O)(O)C1 |
| InChI | InChI=1S/C14H14O4/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17,18)8-11/h1-8,15-18H,9H2 |
| InChIKey | OGENANITSWMABP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|