About (3-acetyloxy-2-hydroxypropyl) 2-methylprop-2-enoate;6-chloro-5-hydroxy-2-methylhex-2-enoic acid
(3-acetyloxy-2-hydroxypropyl) 2-methylprop-2-enoate;6-chloro-5-hydroxy-2-methylhex-2-enoic acid (PubChem CID 175833182) has the molecular formula C16H25ClO8
and a molecular weight of 380.82 g/mol. Its IUPAC name is (3-acetyloxy-2-hydroxypropyl) 2-methylprop-2-enoate;6-chloro-5-hydroxy-2-methylhex-2-enoic acid.
Molecular Properties
| Compound Name | (3-acetyloxy-2-hydroxypropyl) 2-methylprop-2-enoate;6-chloro-5-hydroxy-2-methylhex-2-enoic acid |
| PubChem CID | 175833182 |
| Molecular Formula | C16H25ClO8 |
| Molecular Weight | 380.82 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | (3-acetyloxy-2-hydroxypropyl) 2-methylprop-2-enoate;6-chloro-5-hydroxy-2-methylhex-2-enoic acid |
| SMILES | C=C(C)C(=O)OCC(O)COC(C)=O.CC(=CCC(O)CCl)C(=O)O |
| InChI | InChI=1S/C9H14O5.C7H11ClO3/c1-6(2)9(12)14-5-8(11)4-13-7(3)10;1-5(7(10)11)2-3-6(9)4-8/h8,11H,1,4-5H2,2-3H3;2,6,9H,3-4H2,1H3,(H,10,11) |
| InChIKey | BNHZPXPQZLXGIG-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.82 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3-acetyloxy-2-hydroxypropyl) 2-methylprop-2-enoate;6-chloro-5-hydroxy-2-methylhex-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-acetyloxy-2-hydroxypropyl) 2-methylprop-2-enoate;6-chloro-5-hydroxy-2-methylhex-2-enoic acid?
The IUPAC name of (3-acetyloxy-2-hydroxypropyl) 2-methylprop-2-enoate;6-chloro-5-hydroxy-2-methylhex-2-enoic acid (CID 175833182) is (3-acetyloxy-2-hydroxypropyl) 2-methylprop-2-enoate;6-chloro-5-hydroxy-2-methylhex-2-enoic acid.
What is the SMILES notation for (3-acetyloxy-2-hydroxypropyl) 2-methylprop-2-enoate;6-chloro-5-hydroxy-2-methylhex-2-enoic acid?
The canonical SMILES for (3-acetyloxy-2-hydroxypropyl) 2-methylprop-2-enoate;6-chloro-5-hydroxy-2-methylhex-2-enoic acid is C=C(C)C(=O)OCC(O)COC(C)=O.CC(=CCC(O)CCl)C(=O)O.
What is the InChIKey of (3-acetyloxy-2-hydroxypropyl) 2-methylprop-2-enoate;6-chloro-5-hydroxy-2-methylhex-2-enoic acid?
The InChIKey is BNHZPXPQZLXGIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O5.C7H11ClO3/c1-6(2)9(12)14-5-8(11)4-13-7(3)10;1-5(7(10)11)2-3-6(9)4-8/h8,11H,1,4-5H2,2-3H3;2,6,9H,3-4H2,1H3,(H,10,11).
What are the key properties of (3-acetyloxy-2-hydroxypropyl) 2-methylprop-2-enoate;6-chloro-5-hydroxy-2-methylhex-2-enoic acid?
(3-acetyloxy-2-hydroxypropyl) 2-methylprop-2-enoate;6-chloro-5-hydroxy-2-methylhex-2-enoic acid has a molecular weight of 380.82 g/mol, XLogP of 1.04, 9 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3-acetyloxy-2-hydroxypropyl) 2-methylprop-2-enoate;6-chloro-5-hydroxy-2-methylhex-2-enoic acid is sourced from PubChem (CID 175833182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).