About 1-(2-methoxyethyl)-3-methyl-1,5,9-triazacyclododecane
1-(2-methoxyethyl)-3-methyl-1,5,9-triazacyclododecane (PubChem CID 175833973) has the molecular formula C13H29N3O
and a molecular weight of 243.39 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-methyl-1,5,9-triazacyclododecane.
Molecular Properties
| Compound Name | 1-(2-methoxyethyl)-3-methyl-1,5,9-triazacyclododecane |
| PubChem CID | 175833973 |
| Molecular Formula | C13H29N3O |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.23 |
| IUPAC Name | 1-(2-methoxyethyl)-3-methyl-1,5,9-triazacyclododecane |
| SMILES | COCCN1CCCNCCCNCC(C)C1 |
| InChI | InChI=1S/C13H29N3O/c1-13-11-15-6-3-5-14-7-4-8-16(12-13)9-10-17-2/h13-15H,3-12H2,1-2H3 |
| InChIKey | UAGWJBVYWBVOGK-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-methoxyethyl)-3-methyl-1,5,9-triazacyclododecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methoxyethyl)-3-methyl-1,5,9-triazacyclododecane?
The IUPAC name of 1-(2-methoxyethyl)-3-methyl-1,5,9-triazacyclododecane (CID 175833973) is 1-(2-methoxyethyl)-3-methyl-1,5,9-triazacyclododecane.
What is the SMILES notation for 1-(2-methoxyethyl)-3-methyl-1,5,9-triazacyclododecane?
The canonical SMILES for 1-(2-methoxyethyl)-3-methyl-1,5,9-triazacyclododecane is COCCN1CCCNCCCNCC(C)C1.
What is the InChIKey of 1-(2-methoxyethyl)-3-methyl-1,5,9-triazacyclododecane?
The InChIKey is UAGWJBVYWBVOGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29N3O/c1-13-11-15-6-3-5-14-7-4-8-16(12-13)9-10-17-2/h13-15H,3-12H2,1-2H3.
What are the key properties of 1-(2-methoxyethyl)-3-methyl-1,5,9-triazacyclododecane?
1-(2-methoxyethyl)-3-methyl-1,5,9-triazacyclododecane has a molecular weight of 243.39 g/mol, XLogP of 0.54, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methoxyethyl)-3-methyl-1,5,9-triazacyclododecane is sourced from PubChem (CID 175833973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).