C30H32F2N4O — CID 175834066
1-[(1R)-1-[4-(3,3-difluoropyrrolidin-1-yl)phenyl]ethyl]-4-prop-1-ynyl-N-spiro[3.3]heptan-2-ylindazole-7-carboxamide (PubChem CID 175834066) has the molecular formula C30H32F2N4O and a molecular weight of 502.61 g/mol. Its IUPAC name is 1-[(1R)-1-[4-(3,3-difluoropyrrolidin-1-yl)phenyl]ethyl]-4-prop-1-ynyl-N-spiro[3.3]heptan-2-ylindazole-7-carboxamide.
| Compound Name | 1-[(1R)-1-[4-(3,3-difluoropyrrolidin-1-yl)phenyl]ethyl]-4-prop-1-ynyl-N-spiro[3.3]heptan-2-ylindazole-7-carboxamide |
|---|---|
| PubChem CID | 175834066 |
| Molecular Formula | C30H32F2N4O |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | 1-[(1R)-1-[4-(3,3-difluoropyrrolidin-1-yl)phenyl]ethyl]-4-prop-1-ynyl-N-spiro[3.3]heptan-2-ylindazole-7-carboxamide |
| SMILES | CC#Cc1ccc(C(=O)NC2CC3(CCC3)C2)c2c1cnn2[C@H](C)c1ccc(N2CCC(F)(F)C2)cc1 |
| InChI | InChI=1S/C30H32F2N4O/c1-3-5-22-8-11-25(28(37)34-23-16-29(17-23)12-4-13-29)27-26(22)18-33-36(27)20(2)21-6-9-24(10-7-21)35-15-14-30(31,32)19-35/h6-11,18,20,23H,4,12-17,19H2,1-2H3,(H,34,37)/t20-/m1/s1 |
| InChIKey | OOWDDKAGOYKFHT-HXUWFJFHSA-N |
| XLogP | 5.92 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|