C20H22ClNO5S — CID 175834474
(5R,6S,7S)-3a-[3-[(5-chloro-4-methylthiophen-2-yl)methyl]phenyl]-5-(hydroxymethyl)-2-methyl-5,6,7,7a-tetrahydropyrano[2,3-d][1,3]oxazole-6,7-diol (PubChem CID 175834474) has the molecular formula C20H22ClNO5S and a molecular weight of 423.92 g/mol. Its IUPAC name is (5R,6S,7S)-3a-[3-[(5-chloro-4-methylthiophen-2-yl)methyl]phenyl]-5-(hydroxymethyl)-2-methyl-5,6,7,7a-tetrahydropyrano[2,3-d][1,3]oxazole-6,7-diol.
| Compound Name | (5R,6S,7S)-3a-[3-[(5-chloro-4-methylthiophen-2-yl)methyl]phenyl]-5-(hydroxymethyl)-2-methyl-5,6,7,7a-tetrahydropyrano[2,3-d][1,3]oxazole-6,7-diol |
|---|---|
| PubChem CID | 175834474 |
| Molecular Formula | C20H22ClNO5S |
| Molecular Weight | 423.92 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | (5R,6S,7S)-3a-[3-[(5-chloro-4-methylthiophen-2-yl)methyl]phenyl]-5-(hydroxymethyl)-2-methyl-5,6,7,7a-tetrahydropyrano[2,3-d][1,3]oxazole-6,7-diol |
| SMILES | CC1=NC2(c3cccc(Cc4cc(C)c(Cl)s4)c3)O[C@H](CO)[C@@H](O)[C@H](O)C2O1 |
| InChI | InChI=1S/C20H22ClNO5S/c1-10-6-14(28-19(10)21)8-12-4-3-5-13(7-12)20-18(26-11(2)22-20)17(25)16(24)15(9-23)27-20/h3-7,15-18,23-25H,8-9H2,1-2H3/t15-,16-,17+,18?,20?/m1/s1 |
| InChIKey | WVDYJMGWOOJJKX-NBNWYHCKSA-N |
| XLogP | 2.38 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.92 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |