C8H12F2N2O — CID 175835121
5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide (PubChem CID 175835121) has the molecular formula C8H12F2N2O and a molecular weight of 190.19 g/mol. Its IUPAC name is 5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | 5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 175835121 |
| Molecular Formula | C8H12F2N2O |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
| SMILES | NC(=O)C1NCC2CC(F)(F)CC21 |
| InChI | InChI=1S/C8H12F2N2O/c9-8(10)1-4-3-12-6(7(11)13)5(4)2-8/h4-6,12H,1-3H2,(H2,11,13) |
| InChIKey | QIFLJESQPKEFMV-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |