C29H31N5O6 — CID 175835839
4-[3-[5-(1,3-dioxoisoindol-2-yl)-1,3-dioxan-2-yl]propyl]-3-N-methyl-1-[(1S)-1-phenylethyl]pyrazole-3,5-dicarboxamide (PubChem CID 175835839) has the molecular formula C29H31N5O6 and a molecular weight of 545.60 g/mol. Its IUPAC name is 4-[3-[5-(1,3-dioxoisoindol-2-yl)-1,3-dioxan-2-yl]propyl]-3-N-methyl-1-[(1S)-1-phenylethyl]pyrazole-3,5-dicarboxamide.
| Compound Name | 4-[3-[5-(1,3-dioxoisoindol-2-yl)-1,3-dioxan-2-yl]propyl]-3-N-methyl-1-[(1S)-1-phenylethyl]pyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 175835839 |
| Molecular Formula | C29H31N5O6 |
| Molecular Weight | 545.60 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | 4-[3-[5-(1,3-dioxoisoindol-2-yl)-1,3-dioxan-2-yl]propyl]-3-N-methyl-1-[(1S)-1-phenylethyl]pyrazole-3,5-dicarboxamide |
| SMILES | CNC(=O)c1nn([C@@H](C)c2ccccc2)c(C(N)=O)c1CCCC1OCC(N2C(=O)c3ccccc3C2=O)CO1 |
| InChI | InChI=1S/C29H31N5O6/c1-17(18-9-4-3-5-10-18)34-25(26(30)35)22(24(32-34)27(36)31-2)13-8-14-23-39-15-19(16-40-23)33-28(37)20-11-6-7-12-21(20)29(33)38/h3-7,9-12,17,19,23H,8,13-16H2,1-2H3,(H2,30,35)(H,31,36)/t17-,19?,23?/m0/s1 |
| InChIKey | MRLIFJBKIFNKFS-OYMFQORVSA-N |
| XLogP | 2.31 |
| TPSA | 145.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.60 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|