C15H19N5OS2 — CID 175836432
2-[(1,3-dimethylpyrazol-4-yl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 175836432) has the molecular formula C15H19N5OS2 and a molecular weight of 349.49 g/mol. Its IUPAC name is 2-[(1,3-dimethylpyrazol-4-yl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[(1,3-dimethylpyrazol-4-yl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 175836432 |
| Molecular Formula | C15H19N5OS2 |
| Molecular Weight | 349.49 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 2-[(1,3-dimethylpyrazol-4-yl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1nn(C)cc1NC(=S)Nc1sc2c(c1C(N)=O)CCCC2 |
| InChI | InChI=1S/C15H19N5OS2/c1-8-10(7-20(2)19-8)17-15(22)18-14-12(13(16)21)9-5-3-4-6-11(9)23-14/h7H,3-6H2,1-2H3,(H2,16,21)(H2,17,18,22) |
| InChIKey | LEKBTHQVFGMCBA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|