About 8-oxotricyclo[3.2.1.02,4]octane-6-carboxylic acid
8-oxotricyclo[3.2.1.02,4]octane-6-carboxylic acid (PubChem CID 175836650) has the molecular formula C9H10O3
and a molecular weight of 166.18 g/mol. Its IUPAC name is 8-oxotricyclo[3.2.1.02,4]octane-6-carboxylic acid.
Molecular Properties
| Compound Name | 8-oxotricyclo[3.2.1.02,4]octane-6-carboxylic acid |
| PubChem CID | 175836650 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 8-oxotricyclo[3.2.1.02,4]octane-6-carboxylic acid |
| SMILES | O=C(O)C1CC2C(=O)C1C1CC21 |
| InChI | InChI=1S/C9H10O3/c10-8-5-2-6(9(11)12)7(8)4-1-3(4)5/h3-7H,1-2H2,(H,11,12) |
| InChIKey | VKLDXVIQSMCKLK-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-oxotricyclo[3.2.1.02,4]octane-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-oxotricyclo[3.2.1.02,4]octane-6-carboxylic acid?
The IUPAC name of 8-oxotricyclo[3.2.1.02,4]octane-6-carboxylic acid (CID 175836650) is 8-oxotricyclo[3.2.1.02,4]octane-6-carboxylic acid.
What is the SMILES notation for 8-oxotricyclo[3.2.1.02,4]octane-6-carboxylic acid?
The canonical SMILES for 8-oxotricyclo[3.2.1.02,4]octane-6-carboxylic acid is O=C(O)C1CC2C(=O)C1C1CC21.
What is the InChIKey of 8-oxotricyclo[3.2.1.02,4]octane-6-carboxylic acid?
The InChIKey is VKLDXVIQSMCKLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3/c10-8-5-2-6(9(11)12)7(8)4-1-3(4)5/h3-7H,1-2H2,(H,11,12).
What are the key properties of 8-oxotricyclo[3.2.1.02,4]octane-6-carboxylic acid?
8-oxotricyclo[3.2.1.02,4]octane-6-carboxylic acid has a molecular weight of 166.18 g/mol, XLogP of 0.54, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-oxotricyclo[3.2.1.02,4]octane-6-carboxylic acid is sourced from PubChem (CID 175836650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).