About (2-ethynyloxolan-2-yl)methyl 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate
(2-ethynyloxolan-2-yl)methyl 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate (PubChem CID 175837258) has the molecular formula C22H28O5
and a molecular weight of 372.46 g/mol. Its IUPAC name is (2-ethynyloxolan-2-yl)methyl 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate.
Molecular Properties
| Compound Name | (2-ethynyloxolan-2-yl)methyl 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate |
| PubChem CID | 175837258 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (2-ethynyloxolan-2-yl)methyl 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate |
| SMILES | C#CC1(COC(=O)CC(C)(C)c2c(C)cc(C)cc2OC(C)=O)CCCO1 |
| InChI | InChI=1S/C22H28O5/c1-7-22(9-8-10-26-22)14-25-19(24)13-21(5,6)20-16(3)11-15(2)12-18(20)27-17(4)23/h1,11-12H,8-10,13-14H2,2-6H3 |
| InChIKey | BLVGPSJFNDZFSJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-ethynyloxolan-2-yl)methyl 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethynyloxolan-2-yl)methyl 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate?
The IUPAC name of (2-ethynyloxolan-2-yl)methyl 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate (CID 175837258) is (2-ethynyloxolan-2-yl)methyl 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate.
What is the SMILES notation for (2-ethynyloxolan-2-yl)methyl 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate?
The canonical SMILES for (2-ethynyloxolan-2-yl)methyl 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate is C#CC1(COC(=O)CC(C)(C)c2c(C)cc(C)cc2OC(C)=O)CCCO1.
What is the InChIKey of (2-ethynyloxolan-2-yl)methyl 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate?
The InChIKey is BLVGPSJFNDZFSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28O5/c1-7-22(9-8-10-26-22)14-25-19(24)13-21(5,6)20-16(3)11-15(2)12-18(20)27-17(4)23/h1,11-12H,8-10,13-14H2,2-6H3.
What are the key properties of (2-ethynyloxolan-2-yl)methyl 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate?
(2-ethynyloxolan-2-yl)methyl 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate has a molecular weight of 372.46 g/mol, XLogP of 3.62, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethynyloxolan-2-yl)methyl 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate is sourced from PubChem (CID 175837258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).