C14H27NOSi — CID 175837358
tert-butyl-dimethyl-(2,3,5,6-tetrahydro-1H-pyrrolizin-3-ylmethoxy)silane (PubChem CID 175837358) has the molecular formula C14H27NOSi and a molecular weight of 253.46 g/mol. Its IUPAC name is tert-butyl-dimethyl-(2,3,5,6-tetrahydro-1H-pyrrolizin-3-ylmethoxy)silane.
| Compound Name | tert-butyl-dimethyl-(2,3,5,6-tetrahydro-1H-pyrrolizin-3-ylmethoxy)silane |
|---|---|
| PubChem CID | 175837358 |
| Molecular Formula | C14H27NOSi |
| Molecular Weight | 253.46 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | tert-butyl-dimethyl-(2,3,5,6-tetrahydro-1H-pyrrolizin-3-ylmethoxy)silane |
| SMILES | CC(C)(C)[Si](C)(C)OCC1CCC2=CCCN21 |
| InChI | InChI=1S/C14H27NOSi/c1-14(2,3)17(4,5)16-11-13-9-8-12-7-6-10-15(12)13/h7,13H,6,8-11H2,1-5H3 |
| InChIKey | VBZPXQWUFZQKHW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|