C21H20FN5O3 — CID 175837634
1-(2-fluoro-6-hydroxyphenyl)-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]pyrido[2,3-d]pyrimidin-2-one (PubChem CID 175837634) has the molecular formula C21H20FN5O3 and a molecular weight of 409.42 g/mol. Its IUPAC name is 1-(2-fluoro-6-hydroxyphenyl)-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]pyrido[2,3-d]pyrimidin-2-one.
| Compound Name | 1-(2-fluoro-6-hydroxyphenyl)-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]pyrido[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 175837634 |
| Molecular Formula | C21H20FN5O3 |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 1-(2-fluoro-6-hydroxyphenyl)-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]pyrido[2,3-d]pyrimidin-2-one |
| SMILES | C=CC(=O)N1CCN(c2nc(=O)n(-c3c(O)cccc3F)c3ncccc23)[C@@H](C)C1 |
| InChI | InChI=1S/C21H20FN5O3/c1-3-17(29)25-10-11-26(13(2)12-25)20-14-6-5-9-23-19(14)27(21(30)24-20)18-15(22)7-4-8-16(18)28/h3-9,13,28H,1,10-12H2,2H3/t13-/m0/s1 |
| InChIKey | UDKMCLNPDYYAHW-ZDUSSCGKSA-N |
| XLogP | 1.85 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|