C28H22F12N6O3 — CID 175837682
1-[4-(4-amino-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-5-yl)phenyl]-3-[4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]urea;2,2,2-trifluoroacetic acid (PubChem CID 175837682) has the molecular formula C28H22F12N6O3 and a molecular weight of 718.50 g/mol. Its IUPAC name is 1-[4-(4-amino-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-5-yl)phenyl]-3-[4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[4-(4-amino-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-5-yl)phenyl]-3-[4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175837682 |
| Molecular Formula | C28H22F12N6O3 |
| Molecular Weight | 718.50 g/mol |
| Exact Mass | 718.16 |
| IUPAC Name | 1-[4-(4-amino-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-5-yl)phenyl]-3-[4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]urea;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)n1cc(-c2ccc(NC(=O)Nc3ccc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)cc3)cc2)c2c(N)ncnc21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H21F9N6O.C2HF3O2/c1-13(2)41-11-18(19-20(36)37-12-38-21(19)41)14-3-7-16(8-4-14)39-22(42)40-17-9-5-15(6-10-17)23(27,25(30,31)32)24(28,29)26(33,34)35;3-2(4,5)1(6)7/h3-13H,1-2H3,(H2,36,37,38)(H2,39,40,42);(H,6,7) |
| InChIKey | QKENKZCYQYFWRX-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 135.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.50 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|