C37H31NO9S2 — CID 175837800
2-[4-(4-formyl-1,3-dihydroisoindole-2-carbonyl)-3-(5-methyl-2-sulfophenyl)-5-phenylmethoxyphenyl]-4-methylbenzenesulfonic acid (PubChem CID 175837800) has the molecular formula C37H31NO9S2 and a molecular weight of 697.79 g/mol. Its IUPAC name is 2-[4-(4-formyl-1,3-dihydroisoindole-2-carbonyl)-3-(5-methyl-2-sulfophenyl)-5-phenylmethoxyphenyl]-4-methylbenzenesulfonic acid.
| Compound Name | 2-[4-(4-formyl-1,3-dihydroisoindole-2-carbonyl)-3-(5-methyl-2-sulfophenyl)-5-phenylmethoxyphenyl]-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 175837800 |
| Molecular Formula | C37H31NO9S2 |
| Molecular Weight | 697.79 g/mol |
| Exact Mass | 697.14 |
| IUPAC Name | 2-[4-(4-formyl-1,3-dihydroisoindole-2-carbonyl)-3-(5-methyl-2-sulfophenyl)-5-phenylmethoxyphenyl]-4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(-c2cc(OCc3ccccc3)c(C(=O)N3Cc4cccc(C=O)c4C3)c(-c3cc(C)ccc3S(=O)(=O)O)c2)c1 |
| InChI | InChI=1S/C37H31NO9S2/c1-23-11-13-34(48(41,42)43)29(15-23)28-17-31(30-16-24(2)12-14-35(30)49(44,45)46)36(33(18-28)47-22-25-7-4-3-5-8-25)37(40)38-19-26-9-6-10-27(21-39)32(26)20-38/h3-18,21H,19-20,22H2,1-2H3,(H,41,42,43)(H,44,45,46) |
| InChIKey | LTNBKZROMGPGKZ-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 155.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.79 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|