About methyl 2-[[2-[(2R)-1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetyl]-methylamino]acetate
methyl 2-[[2-[(2R)-1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetyl]-methylamino]acetate (PubChem CID 175838050) has the molecular formula C17H20F2N2O4
and a molecular weight of 354.35 g/mol. Its IUPAC name is methyl 2-[[2-[(2R)-1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetyl]-methylamino]acetate.
Molecular Properties
| Compound Name | methyl 2-[[2-[(2R)-1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetyl]-methylamino]acetate |
| PubChem CID | 175838050 |
| Molecular Formula | C17H20F2N2O4 |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | methyl 2-[[2-[(2R)-1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetyl]-methylamino]acetate |
| SMILES | COC(=O)CN(C)C(=O)C[C@H]1CCC(=O)N1Cc1cccc(F)c1F |
| InChI | InChI=1S/C17H20F2N2O4/c1-20(10-16(24)25-2)15(23)8-12-6-7-14(22)21(12)9-11-4-3-5-13(18)17(11)19/h3-5,12H,6-10H2,1-2H3/t12-/m1/s1 |
| InChIKey | CSMNZSKQZSIIPW-GFCCVEGCSA-N |
| XLogP | 1.48 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[[2-[(2R)-1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetyl]-methylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[2-[(2R)-1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetyl]-methylamino]acetate?
The IUPAC name of methyl 2-[[2-[(2R)-1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetyl]-methylamino]acetate (CID 175838050) is methyl 2-[[2-[(2R)-1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetyl]-methylamino]acetate.
What is the SMILES notation for methyl 2-[[2-[(2R)-1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetyl]-methylamino]acetate?
The canonical SMILES for methyl 2-[[2-[(2R)-1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetyl]-methylamino]acetate is COC(=O)CN(C)C(=O)C[C@H]1CCC(=O)N1Cc1cccc(F)c1F.
What is the InChIKey of methyl 2-[[2-[(2R)-1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetyl]-methylamino]acetate?
The InChIKey is CSMNZSKQZSIIPW-GFCCVEGCSA-N. The full InChI is InChI=1S/C17H20F2N2O4/c1-20(10-16(24)25-2)15(23)8-12-6-7-14(22)21(12)9-11-4-3-5-13(18)17(11)19/h3-5,12H,6-10H2,1-2H3/t12-/m1/s1.
What are the key properties of methyl 2-[[2-[(2R)-1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetyl]-methylamino]acetate?
methyl 2-[[2-[(2R)-1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetyl]-methylamino]acetate has a molecular weight of 354.35 g/mol, XLogP of 1.48, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[2-[(2R)-1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetyl]-methylamino]acetate is sourced from PubChem (CID 175838050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).