About 2-(4-methylphenyl)sulfinylethyl 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate
2-(4-methylphenyl)sulfinylethyl 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate (PubChem CID 175838054) has the molecular formula C22H23F2NO4S
and a molecular weight of 435.49 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfinylethyl 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate.
Molecular Properties
| Compound Name | 2-(4-methylphenyl)sulfinylethyl 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate |
| PubChem CID | 175838054 |
| Molecular Formula | C22H23F2NO4S |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 2-(4-methylphenyl)sulfinylethyl 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate |
| SMILES | Cc1ccc(S(=O)CCOC(=O)CC2CCC(=O)N2Cc2cccc(F)c2F)cc1 |
| InChI | InChI=1S/C22H23F2NO4S/c1-15-5-8-18(9-6-15)30(28)12-11-29-21(27)13-17-7-10-20(26)25(17)14-16-3-2-4-19(23)22(16)24/h2-6,8-9,17H,7,10-14H2,1H3 |
| InChIKey | PLBYODNDPOWVLI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-methylphenyl)sulfinylethyl 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenyl)sulfinylethyl 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate?
The IUPAC name of 2-(4-methylphenyl)sulfinylethyl 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate (CID 175838054) is 2-(4-methylphenyl)sulfinylethyl 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate.
What is the SMILES notation for 2-(4-methylphenyl)sulfinylethyl 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate?
The canonical SMILES for 2-(4-methylphenyl)sulfinylethyl 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate is Cc1ccc(S(=O)CCOC(=O)CC2CCC(=O)N2Cc2cccc(F)c2F)cc1.
What is the InChIKey of 2-(4-methylphenyl)sulfinylethyl 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate?
The InChIKey is PLBYODNDPOWVLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23F2NO4S/c1-15-5-8-18(9-6-15)30(28)12-11-29-21(27)13-17-7-10-20(26)25(17)14-16-3-2-4-19(23)22(16)24/h2-6,8-9,17H,7,10-14H2,1H3.
What are the key properties of 2-(4-methylphenyl)sulfinylethyl 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate?
2-(4-methylphenyl)sulfinylethyl 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate has a molecular weight of 435.49 g/mol, XLogP of 3.51, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenyl)sulfinylethyl 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate is sourced from PubChem (CID 175838054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).