About 2-phenylsulfanylethyl 2-[1-[(3,4-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate
2-phenylsulfanylethyl 2-[1-[(3,4-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate (PubChem CID 175838059) has the molecular formula C21H21F2NO3S
and a molecular weight of 405.47 g/mol. Its IUPAC name is 2-phenylsulfanylethyl 2-[1-[(3,4-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate.
Molecular Properties
| Compound Name | 2-phenylsulfanylethyl 2-[1-[(3,4-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate |
| PubChem CID | 175838059 |
| Molecular Formula | C21H21F2NO3S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 2-phenylsulfanylethyl 2-[1-[(3,4-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate |
| SMILES | O=C(CC1CCC(=O)N1Cc1ccc(F)c(F)c1)OCCSc1ccccc1 |
| InChI | InChI=1S/C21H21F2NO3S/c22-18-8-6-15(12-19(18)23)14-24-16(7-9-20(24)25)13-21(26)27-10-11-28-17-4-2-1-3-5-17/h1-6,8,12,16H,7,9-11,13-14H2 |
| InChIKey | NVQLMJYMDBOVCX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylsulfanylethyl 2-[1-[(3,4-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylsulfanylethyl 2-[1-[(3,4-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate?
The IUPAC name of 2-phenylsulfanylethyl 2-[1-[(3,4-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate (CID 175838059) is 2-phenylsulfanylethyl 2-[1-[(3,4-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate.
What is the SMILES notation for 2-phenylsulfanylethyl 2-[1-[(3,4-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate?
The canonical SMILES for 2-phenylsulfanylethyl 2-[1-[(3,4-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate is O=C(CC1CCC(=O)N1Cc1ccc(F)c(F)c1)OCCSc1ccccc1.
What is the InChIKey of 2-phenylsulfanylethyl 2-[1-[(3,4-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate?
The InChIKey is NVQLMJYMDBOVCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21F2NO3S/c22-18-8-6-15(12-19(18)23)14-24-16(7-9-20(24)25)13-21(26)27-10-11-28-17-4-2-1-3-5-17/h1-6,8,12,16H,7,9-11,13-14H2.
What are the key properties of 2-phenylsulfanylethyl 2-[1-[(3,4-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate?
2-phenylsulfanylethyl 2-[1-[(3,4-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate has a molecular weight of 405.47 g/mol, XLogP of 4.18, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylsulfanylethyl 2-[1-[(3,4-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]acetate is sourced from PubChem (CID 175838059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).