C18H15FN4O2 — CID 175838324
1-[1-(4-cyanophenyl)-5-oxopyrrolidin-3-yl]-3-(4-fluorophenyl)urea (PubChem CID 175838324) has the molecular formula C18H15FN4O2 and a molecular weight of 338.34 g/mol. Its IUPAC name is 1-[1-(4-cyanophenyl)-5-oxopyrrolidin-3-yl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[1-(4-cyanophenyl)-5-oxopyrrolidin-3-yl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 175838324 |
| Molecular Formula | C18H15FN4O2 |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 1-[1-(4-cyanophenyl)-5-oxopyrrolidin-3-yl]-3-(4-fluorophenyl)urea |
| SMILES | N#Cc1ccc(N2CC(NC(=O)Nc3ccc(F)cc3)CC2=O)cc1 |
| InChI | InChI=1S/C18H15FN4O2/c19-13-3-5-14(6-4-13)21-18(25)22-15-9-17(24)23(11-15)16-7-1-12(10-20)2-8-16/h1-8,15H,9,11H2,(H2,21,22,25) |
| InChIKey | HMBCLWBZRMEJLO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |