C22H27N3O4 — CID 175838615
[1-[4-[(4-methoxyphenyl)methoxy]butyl]-4-methylbenzotriazol-5-yl] propanoate (PubChem CID 175838615) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is [1-[4-[(4-methoxyphenyl)methoxy]butyl]-4-methylbenzotriazol-5-yl] propanoate.
| Compound Name | [1-[4-[(4-methoxyphenyl)methoxy]butyl]-4-methylbenzotriazol-5-yl] propanoate |
|---|---|
| PubChem CID | 175838615 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | [1-[4-[(4-methoxyphenyl)methoxy]butyl]-4-methylbenzotriazol-5-yl] propanoate |
| SMILES | CCC(=O)Oc1ccc2c(nnn2CCCCOCc2ccc(OC)cc2)c1C |
| InChI | InChI=1S/C22H27N3O4/c1-4-21(26)29-20-12-11-19-22(16(20)2)23-24-25(19)13-5-6-14-28-15-17-7-9-18(27-3)10-8-17/h7-12H,4-6,13-15H2,1-3H3 |
| InChIKey | SHGWGIGGFAVIFO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|