C18H23N3O4 — CID 175838667
N'-methyl-5-oxo-2-(1,2,3,4-tetrahydronaphthalene-2-carbonylamino)hexanediamide (PubChem CID 175838667) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is N'-methyl-5-oxo-2-(1,2,3,4-tetrahydronaphthalene-2-carbonylamino)hexanediamide.
| Compound Name | N'-methyl-5-oxo-2-(1,2,3,4-tetrahydronaphthalene-2-carbonylamino)hexanediamide |
|---|---|
| PubChem CID | 175838667 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | N'-methyl-5-oxo-2-(1,2,3,4-tetrahydronaphthalene-2-carbonylamino)hexanediamide |
| SMILES | CNC(=O)C(=O)CCC(NC(=O)C1CCc2ccccc2C1)C(N)=O |
| InChI | InChI=1S/C18H23N3O4/c1-20-18(25)15(22)9-8-14(16(19)23)21-17(24)13-7-6-11-4-2-3-5-12(11)10-13/h2-5,13-14H,6-10H2,1H3,(H2,19,23)(H,20,25)(H,21,24) |
| InChIKey | XQUKCGUCSCOQJX-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|