C20H29N5O3 — CID 175838809
1-[5-[3-[(4-deuteriopiperazin-1-yl)methyl]pyrrolidin-1-yl]-2-methoxyphenyl]-1,3-diazinane-2,4-dione (PubChem CID 175838809) has the molecular formula C20H29N5O3 and a molecular weight of 388.49 g/mol. Its IUPAC name is 1-[5-[3-[(4-deuteriopiperazin-1-yl)methyl]pyrrolidin-1-yl]-2-methoxyphenyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[5-[3-[(4-deuteriopiperazin-1-yl)methyl]pyrrolidin-1-yl]-2-methoxyphenyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 175838809 |
| Molecular Formula | C20H29N5O3 |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 1-[5-[3-[(4-deuteriopiperazin-1-yl)methyl]pyrrolidin-1-yl]-2-methoxyphenyl]-1,3-diazinane-2,4-dione |
| SMILES | [2H]N1CCN(CC2CCN(c3ccc(OC)c(N4CCC(=O)NC4=O)c3)C2)CC1 |
| InChI | InChI=1S/C20H29N5O3/c1-28-18-3-2-16(12-17(18)25-9-5-19(26)22-20(25)27)24-8-4-15(14-24)13-23-10-6-21-7-11-23/h2-3,12,15,21H,4-11,13-14H2,1H3,(H,22,26,27)/i/hD |
| InChIKey | UJVKWIDFAWFMQB-DYCDLGHISA-N |
| XLogP | 0.87 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|