About 3-amino-1,2,4-triazine-6-carboxamide
3-amino-1,2,4-triazine-6-carboxamide (PubChem CID 175838852) has the molecular formula C4H5N5O
and a molecular weight of 139.12 g/mol. Its IUPAC name is 3-amino-1,2,4-triazine-6-carboxamide.
Molecular Properties
| Compound Name | 3-amino-1,2,4-triazine-6-carboxamide |
| PubChem CID | 175838852 |
| Molecular Formula | C4H5N5O |
| Molecular Weight | 139.12 g/mol |
| Exact Mass | 139.05 |
| IUPAC Name | 3-amino-1,2,4-triazine-6-carboxamide |
| SMILES | NC(=O)c1cnc(N)nn1 |
| InChI | InChI=1S/C4H5N5O/c5-3(10)2-1-7-4(6)9-8-2/h1H,(H2,5,10)(H2,6,7,9) |
| InChIKey | UOFZNARFNICROC-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 107.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.12 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-1,2,4-triazine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1,2,4-triazine-6-carboxamide?
The IUPAC name of 3-amino-1,2,4-triazine-6-carboxamide (CID 175838852) is 3-amino-1,2,4-triazine-6-carboxamide.
What is the SMILES notation for 3-amino-1,2,4-triazine-6-carboxamide?
The canonical SMILES for 3-amino-1,2,4-triazine-6-carboxamide is NC(=O)c1cnc(N)nn1.
What is the InChIKey of 3-amino-1,2,4-triazine-6-carboxamide?
The InChIKey is UOFZNARFNICROC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N5O/c5-3(10)2-1-7-4(6)9-8-2/h1H,(H2,5,10)(H2,6,7,9).
What are the key properties of 3-amino-1,2,4-triazine-6-carboxamide?
3-amino-1,2,4-triazine-6-carboxamide has a molecular weight of 139.12 g/mol, XLogP of -1.45, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1,2,4-triazine-6-carboxamide is sourced from PubChem (CID 175838852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).