About 1-(6-hydroxyhexyl)-1,2,4-triazole-3-carboxamide
1-(6-hydroxyhexyl)-1,2,4-triazole-3-carboxamide (PubChem CID 175839188) has the molecular formula C9H16N4O2
and a molecular weight of 212.25 g/mol. Its IUPAC name is 1-(6-hydroxyhexyl)-1,2,4-triazole-3-carboxamide.
Molecular Properties
| Compound Name | 1-(6-hydroxyhexyl)-1,2,4-triazole-3-carboxamide |
| PubChem CID | 175839188 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 1-(6-hydroxyhexyl)-1,2,4-triazole-3-carboxamide |
| SMILES | NC(=O)c1ncn(CCCCCCO)n1 |
| InChI | InChI=1S/C9H16N4O2/c10-8(15)9-11-7-13(12-9)5-3-1-2-4-6-14/h7,14H,1-6H2,(H2,10,15) |
| InChIKey | HYUSYHFUCBDNKS-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-hydroxyhexyl)-1,2,4-triazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-hydroxyhexyl)-1,2,4-triazole-3-carboxamide?
The IUPAC name of 1-(6-hydroxyhexyl)-1,2,4-triazole-3-carboxamide (CID 175839188) is 1-(6-hydroxyhexyl)-1,2,4-triazole-3-carboxamide.
What is the SMILES notation for 1-(6-hydroxyhexyl)-1,2,4-triazole-3-carboxamide?
The canonical SMILES for 1-(6-hydroxyhexyl)-1,2,4-triazole-3-carboxamide is NC(=O)c1ncn(CCCCCCO)n1.
What is the InChIKey of 1-(6-hydroxyhexyl)-1,2,4-triazole-3-carboxamide?
The InChIKey is HYUSYHFUCBDNKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O2/c10-8(15)9-11-7-13(12-9)5-3-1-2-4-6-14/h7,14H,1-6H2,(H2,10,15).
What are the key properties of 1-(6-hydroxyhexyl)-1,2,4-triazole-3-carboxamide?
1-(6-hydroxyhexyl)-1,2,4-triazole-3-carboxamide has a molecular weight of 212.25 g/mol, XLogP of -0.07, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-hydroxyhexyl)-1,2,4-triazole-3-carboxamide is sourced from PubChem (CID 175839188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).