C11H20N4O4 — CID 175839202
1-(6,6-dihydroxyhexyl)-N-(2-hydroxyethyl)-1,2,4-triazole-3-carboxamide (PubChem CID 175839202) has the molecular formula C11H20N4O4 and a molecular weight of 272.31 g/mol. Its IUPAC name is 1-(6,6-dihydroxyhexyl)-N-(2-hydroxyethyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-(6,6-dihydroxyhexyl)-N-(2-hydroxyethyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 175839202 |
| Molecular Formula | C11H20N4O4 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 1-(6,6-dihydroxyhexyl)-N-(2-hydroxyethyl)-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(NCCO)c1ncn(CCCCCC(O)O)n1 |
| InChI | InChI=1S/C11H20N4O4/c16-7-5-12-11(19)10-13-8-15(14-10)6-3-1-2-4-9(17)18/h8-9,16-18H,1-7H2,(H,12,19) |
| InChIKey | JPBIIOXLUGCBQN-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|