C29H32AsFN5O2 — CID 175840969
CID 175840969 (PubChem CID 175840969) has the molecular formula C29H32AsFN5O2 and a molecular weight of 576.53 g/mol.
| Compound Name | CID 175840969 |
|---|---|
| PubChem CID | 175840969 |
| Molecular Formula | C29H32AsFN5O2 |
| Molecular Weight | 576.53 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | — |
| SMILES | CCc1[nH]c2ccccc2c1CC[As]c1nc(-c2cncc(F)c2)nc2c1CCN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C29H32AsFN5O2/c1-5-23-21(20-8-6-7-9-24(20)33-23)10-12-30-26-22-11-13-36(28(37)38-29(2,3)4)17-25(22)34-27(35-26)18-14-19(31)16-32-15-18/h6-9,14-16,33H,5,10-13,17H2,1-4H3 |
| InChIKey | VACQPTQGJQHZST-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|