C17H10F3NO2 — CID 175841087
2,2,2-trifluoro-1-(4-hydroxy-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5,7,9(16),10,12,14-heptaen-3-yl)ethanone (PubChem CID 175841087) has the molecular formula C17H10F3NO2 and a molecular weight of 317.27 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(4-hydroxy-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5,7,9(16),10,12,14-heptaen-3-yl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(4-hydroxy-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5,7,9(16),10,12,14-heptaen-3-yl)ethanone |
|---|---|
| PubChem CID | 175841087 |
| Molecular Formula | C17H10F3NO2 |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 2,2,2-trifluoro-1-(4-hydroxy-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5,7,9(16),10,12,14-heptaen-3-yl)ethanone |
| SMILES | O=C(C1=C(O)c2cccc3c4ccccc4n(c23)C1)C(F)(F)F |
| InChI | InChI=1S/C17H10F3NO2/c18-17(19,20)16(23)12-8-21-13-7-2-1-4-9(13)10-5-3-6-11(14(10)21)15(12)22/h1-7,22H,8H2 |
| InChIKey | PMPTXFFPGCZHCJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |