C21H12F3NO2 — CID 175841112
2,2,2-trifluoro-1-(3-hydroxy-4-phenylbenzo[h]quinolin-2-yl)ethanone (PubChem CID 175841112) has the molecular formula C21H12F3NO2 and a molecular weight of 367.33 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(3-hydroxy-4-phenylbenzo[h]quinolin-2-yl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(3-hydroxy-4-phenylbenzo[h]quinolin-2-yl)ethanone |
|---|---|
| PubChem CID | 175841112 |
| Molecular Formula | C21H12F3NO2 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 2,2,2-trifluoro-1-(3-hydroxy-4-phenylbenzo[h]quinolin-2-yl)ethanone |
| SMILES | O=C(c1nc2c(ccc3ccccc32)c(-c2ccccc2)c1O)C(F)(F)F |
| InChI | InChI=1S/C21H12F3NO2/c22-21(23,24)20(27)18-19(26)16(13-7-2-1-3-8-13)15-11-10-12-6-4-5-9-14(12)17(15)25-18/h1-11,26H |
| InChIKey | HBGNRBBNGRTJCN-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|