C18H20N2O4 — CID 175841368
(E)-but-2-enedioic acid;N-[(2-pyridin-4-ylphenyl)methyl]ethanamine (PubChem CID 175841368) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-[(2-pyridin-4-ylphenyl)methyl]ethanamine.
| Compound Name | (E)-but-2-enedioic acid;N-[(2-pyridin-4-ylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 175841368 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (E)-but-2-enedioic acid;N-[(2-pyridin-4-ylphenyl)methyl]ethanamine |
| SMILES | CCNCc1ccccc1-c1ccncc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C14H16N2.C4H4O4/c1-2-15-11-13-5-3-4-6-14(13)12-7-9-16-10-8-12;5-3(6)1-2-4(7)8/h3-10,15H,2,11H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | TYEWAVUHTLHYLC-WLHGVMLRSA-N |
| XLogP | 2.57 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|