About 2-ethyl-5-(furan-2-yl)-1,6-dimethyl-4-oxopyridine-3-carboxamide
2-ethyl-5-(furan-2-yl)-1,6-dimethyl-4-oxopyridine-3-carboxamide (PubChem CID 175841746) has the molecular formula C14H16N2O3
and a molecular weight of 260.29 g/mol. Its IUPAC name is 2-ethyl-5-(furan-2-yl)-1,6-dimethyl-4-oxopyridine-3-carboxamide.
Molecular Properties
| Compound Name | 2-ethyl-5-(furan-2-yl)-1,6-dimethyl-4-oxopyridine-3-carboxamide |
| PubChem CID | 175841746 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 2-ethyl-5-(furan-2-yl)-1,6-dimethyl-4-oxopyridine-3-carboxamide |
| SMILES | CCc1c(C(N)=O)c(=O)c(-c2ccco2)c(C)n1C |
| InChI | InChI=1S/C14H16N2O3/c1-4-9-12(14(15)18)13(17)11(8(2)16(9)3)10-6-5-7-19-10/h5-7H,4H2,1-3H3,(H2,15,18) |
| InChIKey | GPSDRGBPNNFEAC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 78.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethyl-5-(furan-2-yl)-1,6-dimethyl-4-oxopyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5-(furan-2-yl)-1,6-dimethyl-4-oxopyridine-3-carboxamide?
The IUPAC name of 2-ethyl-5-(furan-2-yl)-1,6-dimethyl-4-oxopyridine-3-carboxamide (CID 175841746) is 2-ethyl-5-(furan-2-yl)-1,6-dimethyl-4-oxopyridine-3-carboxamide.
What is the SMILES notation for 2-ethyl-5-(furan-2-yl)-1,6-dimethyl-4-oxopyridine-3-carboxamide?
The canonical SMILES for 2-ethyl-5-(furan-2-yl)-1,6-dimethyl-4-oxopyridine-3-carboxamide is CCc1c(C(N)=O)c(=O)c(-c2ccco2)c(C)n1C.
What is the InChIKey of 2-ethyl-5-(furan-2-yl)-1,6-dimethyl-4-oxopyridine-3-carboxamide?
The InChIKey is GPSDRGBPNNFEAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O3/c1-4-9-12(14(15)18)13(17)11(8(2)16(9)3)10-6-5-7-19-10/h5-7H,4H2,1-3H3,(H2,15,18).
What are the key properties of 2-ethyl-5-(furan-2-yl)-1,6-dimethyl-4-oxopyridine-3-carboxamide?
2-ethyl-5-(furan-2-yl)-1,6-dimethyl-4-oxopyridine-3-carboxamide has a molecular weight of 260.29 g/mol, XLogP of 1.62, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5-(furan-2-yl)-1,6-dimethyl-4-oxopyridine-3-carboxamide is sourced from PubChem (CID 175841746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).