C32H37F3N4O — CID 175841865
3-[4-[5-butyl-1-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,2,4-triazol-3-yl]phenoxy]-N,N-diethylpropan-1-amine (PubChem CID 175841865) has the molecular formula C32H37F3N4O and a molecular weight of 550.67 g/mol. Its IUPAC name is 3-[4-[5-butyl-1-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,2,4-triazol-3-yl]phenoxy]-N,N-diethylpropan-1-amine.
| Compound Name | 3-[4-[5-butyl-1-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,2,4-triazol-3-yl]phenoxy]-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 175841865 |
| Molecular Formula | C32H37F3N4O |
| Molecular Weight | 550.67 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | 3-[4-[5-butyl-1-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,2,4-triazol-3-yl]phenoxy]-N,N-diethylpropan-1-amine |
| SMILES | CCCCc1nc(-c2ccc(OCCCN(CC)CC)cc2)nn1-c1ccc(-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C32H37F3N4O/c1-4-7-9-30-36-31(26-14-20-29(21-15-26)40-23-8-22-38(5-2)6-3)37-39(30)28-18-12-25(13-19-28)24-10-16-27(17-11-24)32(33,34)35/h10-21H,4-9,22-23H2,1-3H3 |
| InChIKey | UWGIWHFUJANQEG-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.67 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|